C28H28N2O — CID 58932997
1-(2,5-diphenyl-1,3-oxazol-4-yl)-N-[2,6-di(propan-2-yl)phenyl]methanimine (PubChem CID 58932997) has the molecular formula C28H28N2O and a molecular weight of 408.55 g/mol. Its IUPAC name is 1-(2,5-diphenyl-1,3-oxazol-4-yl)-N-[2,6-di(propan-2-yl)phenyl]methanimine.
| Compound Name | 1-(2,5-diphenyl-1,3-oxazol-4-yl)-N-[2,6-di(propan-2-yl)phenyl]methanimine |
|---|---|
| PubChem CID | 58932997 |
| Molecular Formula | C28H28N2O |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 1-(2,5-diphenyl-1,3-oxazol-4-yl)-N-[2,6-di(propan-2-yl)phenyl]methanimine |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C/c1nc(-c2ccccc2)oc1-c1ccccc1 |
| InChI | InChI=1S/C28H28N2O/c1-19(2)23-16-11-17-24(20(3)4)26(23)29-18-25-27(21-12-7-5-8-13-21)31-28(30-25)22-14-9-6-10-15-22/h5-20H,1-4H3/b29-18+ |
| InChIKey | WDZIVVCFHMHKTO-RDRPBHBLSA-N |
| XLogP | 8.01 |
| TPSA | 38.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|