About N-[[4-(3-chlorophenyl)-1,3-thiazol-2-yl]-phenylmethyl]-2,6-di(propan-2-yl)aniline
N-[[4-(3-chlorophenyl)-1,3-thiazol-2-yl]-phenylmethyl]-2,6-di(propan-2-yl)aniline (PubChem CID 58933179) has the molecular formula C28H29ClN2S
and a molecular weight of 461.07 g/mol. Its IUPAC name is N-[[4-(3-chlorophenyl)-1,3-thiazol-2-yl]-phenylmethyl]-2,6-di(propan-2-yl)aniline.
Molecular Properties
| Compound Name | N-[[4-(3-chlorophenyl)-1,3-thiazol-2-yl]-phenylmethyl]-2,6-di(propan-2-yl)aniline |
| PubChem CID | 58933179 |
| Molecular Formula | C28H29ClN2S |
| Molecular Weight | 461.07 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | N-[[4-(3-chlorophenyl)-1,3-thiazol-2-yl]-phenylmethyl]-2,6-di(propan-2-yl)aniline |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(c1ccccc1)c1nc(-c2cccc(Cl)c2)cs1 |
| InChI | InChI=1S/C28H29ClN2S/c1-18(2)23-14-9-15-24(19(3)4)27(23)31-26(20-10-6-5-7-11-20)28-30-25(17-32-28)21-12-8-13-22(29)16-21/h5-19,26,31H,1-4H3 |
| InChIKey | GBDAUTRALZIGLD-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.07 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[4-(3-chlorophenyl)-1,3-thiazol-2-yl]-phenylmethyl]-2,6-di(propan-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(3-chlorophenyl)-1,3-thiazol-2-yl]-phenylmethyl]-2,6-di(propan-2-yl)aniline?
The IUPAC name of N-[[4-(3-chlorophenyl)-1,3-thiazol-2-yl]-phenylmethyl]-2,6-di(propan-2-yl)aniline (CID 58933179) is N-[[4-(3-chlorophenyl)-1,3-thiazol-2-yl]-phenylmethyl]-2,6-di(propan-2-yl)aniline.
What is the SMILES notation for N-[[4-(3-chlorophenyl)-1,3-thiazol-2-yl]-phenylmethyl]-2,6-di(propan-2-yl)aniline?
The canonical SMILES for N-[[4-(3-chlorophenyl)-1,3-thiazol-2-yl]-phenylmethyl]-2,6-di(propan-2-yl)aniline is CC(C)c1cccc(C(C)C)c1NC(c1ccccc1)c1nc(-c2cccc(Cl)c2)cs1.
What is the InChIKey of N-[[4-(3-chlorophenyl)-1,3-thiazol-2-yl]-phenylmethyl]-2,6-di(propan-2-yl)aniline?
The InChIKey is GBDAUTRALZIGLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H29ClN2S/c1-18(2)23-14-9-15-24(19(3)4)27(23)31-26(20-10-6-5-7-11-20)28-30-25(17-32-28)21-12-8-13-22(29)16-21/h5-19,26,31H,1-4H3.
What are the key properties of N-[[4-(3-chlorophenyl)-1,3-thiazol-2-yl]-phenylmethyl]-2,6-di(propan-2-yl)aniline?
N-[[4-(3-chlorophenyl)-1,3-thiazol-2-yl]-phenylmethyl]-2,6-di(propan-2-yl)aniline has a molecular weight of 461.07 g/mol, XLogP of 8.91, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(3-chlorophenyl)-1,3-thiazol-2-yl]-phenylmethyl]-2,6-di(propan-2-yl)aniline is sourced from PubChem (CID 58933179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).