C17H23N3OS — CID 58933544
N-[[1-[(5-methylthiophen-2-yl)methyl]piperidin-4-yl]methyl]-1H-pyrrole-3-carboxamide (PubChem CID 58933544) has the molecular formula C17H23N3OS and a molecular weight of 317.46 g/mol. Its IUPAC name is N-[[1-[(5-methylthiophen-2-yl)methyl]piperidin-4-yl]methyl]-1H-pyrrole-3-carboxamide.
| Compound Name | N-[[1-[(5-methylthiophen-2-yl)methyl]piperidin-4-yl]methyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 58933544 |
| Molecular Formula | C17H23N3OS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | N-[[1-[(5-methylthiophen-2-yl)methyl]piperidin-4-yl]methyl]-1H-pyrrole-3-carboxamide |
| SMILES | Cc1ccc(CN2CCC(CNC(=O)c3cc[nH]c3)CC2)s1 |
| InChI | InChI=1S/C17H23N3OS/c1-13-2-3-16(22-13)12-20-8-5-14(6-9-20)10-19-17(21)15-4-7-18-11-15/h2-4,7,11,14,18H,5-6,8-10,12H2,1H3,(H,19,21) |
| InChIKey | WEFQGAMKLVCQTL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |