About benzyl 4-[(1,6-naphthyridine-2-carbonylamino)methyl]piperidine-1-carboxylate
benzyl 4-[(1,6-naphthyridine-2-carbonylamino)methyl]piperidine-1-carboxylate (PubChem CID 58933576) has the molecular formula C23H24N4O3
and a molecular weight of 404.47 g/mol. Its IUPAC name is benzyl 4-[(1,6-naphthyridine-2-carbonylamino)methyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | benzyl 4-[(1,6-naphthyridine-2-carbonylamino)methyl]piperidine-1-carboxylate |
| PubChem CID | 58933576 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | benzyl 4-[(1,6-naphthyridine-2-carbonylamino)methyl]piperidine-1-carboxylate |
| SMILES | O=C(NCC1CCN(C(=O)OCc2ccccc2)CC1)c1ccc2cnccc2n1 |
| InChI | InChI=1S/C23H24N4O3/c28-22(21-7-6-19-15-24-11-8-20(19)26-21)25-14-17-9-12-27(13-10-17)23(29)30-16-18-4-2-1-3-5-18/h1-8,11,15,17H,9-10,12-14,16H2,(H,25,28) |
| InChIKey | KDXPOALRJTXKHK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl 4-[(1,6-naphthyridine-2-carbonylamino)methyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-[(1,6-naphthyridine-2-carbonylamino)methyl]piperidine-1-carboxylate?
The IUPAC name of benzyl 4-[(1,6-naphthyridine-2-carbonylamino)methyl]piperidine-1-carboxylate (CID 58933576) is benzyl 4-[(1,6-naphthyridine-2-carbonylamino)methyl]piperidine-1-carboxylate.
What is the SMILES notation for benzyl 4-[(1,6-naphthyridine-2-carbonylamino)methyl]piperidine-1-carboxylate?
The canonical SMILES for benzyl 4-[(1,6-naphthyridine-2-carbonylamino)methyl]piperidine-1-carboxylate is O=C(NCC1CCN(C(=O)OCc2ccccc2)CC1)c1ccc2cnccc2n1.
What is the InChIKey of benzyl 4-[(1,6-naphthyridine-2-carbonylamino)methyl]piperidine-1-carboxylate?
The InChIKey is KDXPOALRJTXKHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N4O3/c28-22(21-7-6-19-15-24-11-8-20(19)26-21)25-14-17-9-12-27(13-10-17)23(29)30-16-18-4-2-1-3-5-18/h1-8,11,15,17H,9-10,12-14,16H2,(H,25,28).
What are the key properties of benzyl 4-[(1,6-naphthyridine-2-carbonylamino)methyl]piperidine-1-carboxylate?
benzyl 4-[(1,6-naphthyridine-2-carbonylamino)methyl]piperidine-1-carboxylate has a molecular weight of 404.47 g/mol, XLogP of 3.41, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-[(1,6-naphthyridine-2-carbonylamino)methyl]piperidine-1-carboxylate is sourced from PubChem (CID 58933576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).