About benzyl 2-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]morpholine-4-carboxylate
benzyl 2-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]morpholine-4-carboxylate (PubChem CID 58933772) has the molecular formula C21H21N3O6
and a molecular weight of 411.41 g/mol. Its IUPAC name is benzyl 2-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]morpholine-4-carboxylate.
Molecular Properties
| Compound Name | benzyl 2-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]morpholine-4-carboxylate |
| PubChem CID | 58933772 |
| Molecular Formula | C21H21N3O6 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | benzyl 2-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]morpholine-4-carboxylate |
| SMILES | O=C(NCC1CN(C(=O)OCc2ccccc2)CCO1)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C21H21N3O6/c25-19(15-6-7-17-18(10-15)30-20(26)23-17)22-11-16-12-24(8-9-28-16)21(27)29-13-14-4-2-1-3-5-14/h1-7,10,16H,8-9,11-13H2,(H,22,25)(H,23,26) |
| InChIKey | FSVORHFGRZCNJT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze benzyl 2-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]morpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]morpholine-4-carboxylate?
The IUPAC name of benzyl 2-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]morpholine-4-carboxylate (CID 58933772) is benzyl 2-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]morpholine-4-carboxylate.
What is the SMILES notation for benzyl 2-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]morpholine-4-carboxylate?
The canonical SMILES for benzyl 2-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]morpholine-4-carboxylate is O=C(NCC1CN(C(=O)OCc2ccccc2)CCO1)c1ccc2[nH]c(=O)oc2c1.
What is the InChIKey of benzyl 2-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]morpholine-4-carboxylate?
The InChIKey is FSVORHFGRZCNJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3O6/c25-19(15-6-7-17-18(10-15)30-20(26)23-17)22-11-16-12-24(8-9-28-16)21(27)29-13-14-4-2-1-3-5-14/h1-7,10,16H,8-9,11-13H2,(H,22,25)(H,23,26).
What are the key properties of benzyl 2-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]morpholine-4-carboxylate?
benzyl 2-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]morpholine-4-carboxylate has a molecular weight of 411.41 g/mol, XLogP of 1.89, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]morpholine-4-carboxylate is sourced from PubChem (CID 58933772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).