About benzyl 3-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]piperazine-1-carboxylate
benzyl 3-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]piperazine-1-carboxylate (PubChem CID 58933838) has the molecular formula C21H22N4O5
and a molecular weight of 410.43 g/mol. Its IUPAC name is benzyl 3-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | benzyl 3-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]piperazine-1-carboxylate |
| PubChem CID | 58933838 |
| Molecular Formula | C21H22N4O5 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | benzyl 3-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]piperazine-1-carboxylate |
| SMILES | O=C(NCC1CN(C(=O)OCc2ccccc2)CCN1)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C21H22N4O5/c26-19(15-6-7-17-18(10-15)30-20(27)24-17)23-11-16-12-25(9-8-22-16)21(28)29-13-14-4-2-1-3-5-14/h1-7,10,16,22H,8-9,11-13H2,(H,23,26)(H,24,27) |
| InChIKey | YJGNRBCCRBHODN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze benzyl 3-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 3-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]piperazine-1-carboxylate?
The IUPAC name of benzyl 3-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]piperazine-1-carboxylate (CID 58933838) is benzyl 3-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]piperazine-1-carboxylate.
What is the SMILES notation for benzyl 3-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]piperazine-1-carboxylate?
The canonical SMILES for benzyl 3-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]piperazine-1-carboxylate is O=C(NCC1CN(C(=O)OCc2ccccc2)CCN1)c1ccc2[nH]c(=O)oc2c1.
What is the InChIKey of benzyl 3-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]piperazine-1-carboxylate?
The InChIKey is YJGNRBCCRBHODN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N4O5/c26-19(15-6-7-17-18(10-15)30-20(27)24-17)23-11-16-12-25(9-8-22-16)21(28)29-13-14-4-2-1-3-5-14/h1-7,10,16,22H,8-9,11-13H2,(H,23,26)(H,24,27).
What are the key properties of benzyl 3-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]piperazine-1-carboxylate?
benzyl 3-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]piperazine-1-carboxylate has a molecular weight of 410.43 g/mol, XLogP of 1.46, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-[[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]methyl]piperazine-1-carboxylate is sourced from PubChem (CID 58933838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).