C25H26O2 — CID 58934325
2-hydroxy-5-(5,5,8,8-tetramethyl-6,7-dihydroanthracen-2-yl)cyclohepta-2,4,6-trien-1-one (PubChem CID 58934325) has the molecular formula C25H26O2 and a molecular weight of 358.48 g/mol. Its IUPAC name is 2-hydroxy-5-(5,5,8,8-tetramethyl-6,7-dihydroanthracen-2-yl)cyclohepta-2,4,6-trien-1-one.
| Compound Name | 2-hydroxy-5-(5,5,8,8-tetramethyl-6,7-dihydroanthracen-2-yl)cyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 58934325 |
| Molecular Formula | C25H26O2 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 2-hydroxy-5-(5,5,8,8-tetramethyl-6,7-dihydroanthracen-2-yl)cyclohepta-2,4,6-trien-1-one |
| SMILES | CC1(C)CCC(C)(C)c2cc3cc(-c4ccc(O)c(=O)cc4)ccc3cc21 |
| InChI | InChI=1S/C25H26O2/c1-24(2)11-12-25(3,4)21-15-19-13-17(5-6-18(19)14-20(21)24)16-7-9-22(26)23(27)10-8-16/h5-10,13-15H,11-12H2,1-4H3,(H,26,27) |
| InChIKey | FVCXZRHRCDTBIA-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |