C20H24O2 — CID 58935080
(4E,6E,8E)-9-[2-[(1E,3E)-penta-1,3-dienyl]phenyl]nona-4,6,8-triene-2,3-diol (PubChem CID 58935080) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is (4E,6E,8E)-9-[2-[(1E,3E)-penta-1,3-dienyl]phenyl]nona-4,6,8-triene-2,3-diol.
| Compound Name | (4E,6E,8E)-9-[2-[(1E,3E)-penta-1,3-dienyl]phenyl]nona-4,6,8-triene-2,3-diol |
|---|---|
| PubChem CID | 58935080 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (4E,6E,8E)-9-[2-[(1E,3E)-penta-1,3-dienyl]phenyl]nona-4,6,8-triene-2,3-diol |
| SMILES | C/C=C/C=C/c1ccccc1/C=C/C=C/C=C/C(O)C(C)O |
| InChI | InChI=1S/C20H24O2/c1-3-4-7-12-18-14-10-11-15-19(18)13-8-5-6-9-16-20(22)17(2)21/h3-17,20-22H,1-2H3/b4-3+,6-5+,12-7+,13-8+,16-9+ |
| InChIKey | FRGLBHCNWJWIPR-FZPCCFHPSA-N |
| XLogP | 4.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|