About (tert-butylamino) 2-amino-3-(oxaldehydoylamino)propanoate
(tert-butylamino) 2-amino-3-(oxaldehydoylamino)propanoate (PubChem CID 58935150) has the molecular formula C9H17N3O4
and a molecular weight of 231.25 g/mol. Its IUPAC name is (tert-butylamino) 2-amino-3-(oxaldehydoylamino)propanoate.
Molecular Properties
| Compound Name | (tert-butylamino) 2-amino-3-(oxaldehydoylamino)propanoate |
| PubChem CID | 58935150 |
| Molecular Formula | C9H17N3O4 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | (tert-butylamino) 2-amino-3-(oxaldehydoylamino)propanoate |
| SMILES | CC(C)(C)NOC(=O)C(N)CNC(=O)C=O |
| InChI | InChI=1S/C9H17N3O4/c1-9(2,3)12-16-8(15)6(10)4-11-7(14)5-13/h5-6,12H,4,10H2,1-3H3,(H,11,14) |
| InChIKey | WECVNQDHVAEUKA-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (tert-butylamino) 2-amino-3-(oxaldehydoylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (tert-butylamino) 2-amino-3-(oxaldehydoylamino)propanoate?
The IUPAC name of (tert-butylamino) 2-amino-3-(oxaldehydoylamino)propanoate (CID 58935150) is (tert-butylamino) 2-amino-3-(oxaldehydoylamino)propanoate.
What is the SMILES notation for (tert-butylamino) 2-amino-3-(oxaldehydoylamino)propanoate?
The canonical SMILES for (tert-butylamino) 2-amino-3-(oxaldehydoylamino)propanoate is CC(C)(C)NOC(=O)C(N)CNC(=O)C=O.
What is the InChIKey of (tert-butylamino) 2-amino-3-(oxaldehydoylamino)propanoate?
The InChIKey is WECVNQDHVAEUKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O4/c1-9(2,3)12-16-8(15)6(10)4-11-7(14)5-13/h5-6,12H,4,10H2,1-3H3,(H,11,14).
What are the key properties of (tert-butylamino) 2-amino-3-(oxaldehydoylamino)propanoate?
(tert-butylamino) 2-amino-3-(oxaldehydoylamino)propanoate has a molecular weight of 231.25 g/mol, XLogP of -1.52, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (tert-butylamino) 2-amino-3-(oxaldehydoylamino)propanoate is sourced from PubChem (CID 58935150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).