About 1-(1,4,7-dioxazonan-7-yl)butan-2-yl 7-oxabicyclo[2.2.1]heptane-2-carboxylate
1-(1,4,7-dioxazonan-7-yl)butan-2-yl 7-oxabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 58935229) has the molecular formula C17H29NO5
and a molecular weight of 327.42 g/mol. Its IUPAC name is 1-(1,4,7-dioxazonan-7-yl)butan-2-yl 7-oxabicyclo[2.2.1]heptane-2-carboxylate.
Molecular Properties
| Compound Name | 1-(1,4,7-dioxazonan-7-yl)butan-2-yl 7-oxabicyclo[2.2.1]heptane-2-carboxylate |
| PubChem CID | 58935229 |
| Molecular Formula | C17H29NO5 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | 1-(1,4,7-dioxazonan-7-yl)butan-2-yl 7-oxabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CCC(CN1CCOCCOCC1)OC(=O)C1CC2CCC1O2 |
| InChI | InChI=1S/C17H29NO5/c1-2-13(12-18-5-7-20-9-10-21-8-6-18)23-17(19)15-11-14-3-4-16(15)22-14/h13-16H,2-12H2,1H3 |
| InChIKey | QPCCLNSVGNXKAM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(1,4,7-dioxazonan-7-yl)butan-2-yl 7-oxabicyclo[2.2.1]heptane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,4,7-dioxazonan-7-yl)butan-2-yl 7-oxabicyclo[2.2.1]heptane-2-carboxylate?
The IUPAC name of 1-(1,4,7-dioxazonan-7-yl)butan-2-yl 7-oxabicyclo[2.2.1]heptane-2-carboxylate (CID 58935229) is 1-(1,4,7-dioxazonan-7-yl)butan-2-yl 7-oxabicyclo[2.2.1]heptane-2-carboxylate.
What is the SMILES notation for 1-(1,4,7-dioxazonan-7-yl)butan-2-yl 7-oxabicyclo[2.2.1]heptane-2-carboxylate?
The canonical SMILES for 1-(1,4,7-dioxazonan-7-yl)butan-2-yl 7-oxabicyclo[2.2.1]heptane-2-carboxylate is CCC(CN1CCOCCOCC1)OC(=O)C1CC2CCC1O2.
What is the InChIKey of 1-(1,4,7-dioxazonan-7-yl)butan-2-yl 7-oxabicyclo[2.2.1]heptane-2-carboxylate?
The InChIKey is QPCCLNSVGNXKAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29NO5/c1-2-13(12-18-5-7-20-9-10-21-8-6-18)23-17(19)15-11-14-3-4-16(15)22-14/h13-16H,2-12H2,1H3.
What are the key properties of 1-(1,4,7-dioxazonan-7-yl)butan-2-yl 7-oxabicyclo[2.2.1]heptane-2-carboxylate?
1-(1,4,7-dioxazonan-7-yl)butan-2-yl 7-oxabicyclo[2.2.1]heptane-2-carboxylate has a molecular weight of 327.42 g/mol, XLogP of 1.22, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,4,7-dioxazonan-7-yl)butan-2-yl 7-oxabicyclo[2.2.1]heptane-2-carboxylate is sourced from PubChem (CID 58935229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).