About 1-[(2S,4R)-1-tert-butyl-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one
1-[(2S,4R)-1-tert-butyl-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one (PubChem CID 58935323) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is 1-[(2S,4R)-1-tert-butyl-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one.
Molecular Properties
| Compound Name | 1-[(2S,4R)-1-tert-butyl-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one |
| PubChem CID | 58935323 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 1-[(2S,4R)-1-tert-butyl-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)[C@@H]1C[C@@H](O)CN1C(C)(C)C |
| InChI | InChI=1S/C13H25NO2/c1-12(2,3)11(16)10-7-9(15)8-14(10)13(4,5)6/h9-10,15H,7-8H2,1-6H3/t9-,10+/m1/s1 |
| InChIKey | YWSJYTIZQPZMFM-ZJUUUORDSA-N |
| XLogP | 1.84 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(2S,4R)-1-tert-butyl-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S,4R)-1-tert-butyl-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one?
The IUPAC name of 1-[(2S,4R)-1-tert-butyl-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one (CID 58935323) is 1-[(2S,4R)-1-tert-butyl-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one.
What is the SMILES notation for 1-[(2S,4R)-1-tert-butyl-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one?
The canonical SMILES for 1-[(2S,4R)-1-tert-butyl-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one is CC(C)(C)C(=O)[C@@H]1C[C@@H](O)CN1C(C)(C)C.
What is the InChIKey of 1-[(2S,4R)-1-tert-butyl-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one?
The InChIKey is YWSJYTIZQPZMFM-ZJUUUORDSA-N. The full InChI is InChI=1S/C13H25NO2/c1-12(2,3)11(16)10-7-9(15)8-14(10)13(4,5)6/h9-10,15H,7-8H2,1-6H3/t9-,10+/m1/s1.
What are the key properties of 1-[(2S,4R)-1-tert-butyl-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one?
1-[(2S,4R)-1-tert-butyl-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one has a molecular weight of 227.35 g/mol, XLogP of 1.84, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S,4R)-1-tert-butyl-4-hydroxypyrrolidin-2-yl]-2,2-dimethylpropan-1-one is sourced from PubChem (CID 58935323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).