C16H15Cl2F3N6O — CID 58935461
5-chloro-3-(chloromethyl)-N-(4-methyl-2-pyridinyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 58935461) has the molecular formula C16H15Cl2F3N6O and a molecular weight of 435.24 g/mol. Its IUPAC name is 5-chloro-3-(chloromethyl)-N-(4-methyl-2-pyridinyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 5-chloro-3-(chloromethyl)-N-(4-methyl-2-pyridinyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 58935461 |
| Molecular Formula | C16H15Cl2F3N6O |
| Molecular Weight | 435.24 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | 5-chloro-3-(chloromethyl)-N-(4-methyl-2-pyridinyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | Cc1ccnc(Nc2nc(Cl)nc3c(CCl)nn(CCOCC(F)(F)F)c23)c1 |
| InChI | InChI=1S/C16H15Cl2F3N6O/c1-9-2-3-22-11(6-9)23-14-13-12(24-15(18)25-14)10(7-17)26-27(13)4-5-28-8-16(19,20)21/h2-3,6H,4-5,7-8H2,1H3,(H,22,23,24,25) |
| InChIKey | DIAUUKAUECRZJM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.24 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|