C10H11F3N4O3 — CID 58935483
3-methyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]-4H-pyrazolo[4,5-d]pyrimidine-5,7-dione (PubChem CID 58935483) has the molecular formula C10H11F3N4O3 and a molecular weight of 292.22 g/mol. Its IUPAC name is 3-methyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]-4H-pyrazolo[4,5-d]pyrimidine-5,7-dione.
| Compound Name | 3-methyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]-4H-pyrazolo[4,5-d]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 58935483 |
| Molecular Formula | C10H11F3N4O3 |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 3-methyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]-4H-pyrazolo[4,5-d]pyrimidine-5,7-dione |
| SMILES | Cc1nn(CCOCC(F)(F)F)c2c(=O)[nH]c(=O)[nH]c12 |
| InChI | InChI=1S/C10H11F3N4O3/c1-5-6-7(8(18)15-9(19)14-6)17(16-5)2-3-20-4-10(11,12)13/h2-4H2,1H3,(H2,14,15,18,19) |
| InChIKey | JEPZQWDQQJSWHZ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 92.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|