C11H13F3N4O3 — CID 58935532
3-ethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]-4H-pyrazolo[4,5-d]pyrimidine-5,7-dione (PubChem CID 58935532) has the molecular formula C11H13F3N4O3 and a molecular weight of 306.24 g/mol. Its IUPAC name is 3-ethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]-4H-pyrazolo[4,5-d]pyrimidine-5,7-dione.
| Compound Name | 3-ethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]-4H-pyrazolo[4,5-d]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 58935532 |
| Molecular Formula | C11H13F3N4O3 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 3-ethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]-4H-pyrazolo[4,5-d]pyrimidine-5,7-dione |
| SMILES | CCc1nn(CCOCC(F)(F)F)c2c(=O)[nH]c(=O)[nH]c12 |
| InChI | InChI=1S/C11H13F3N4O3/c1-2-6-7-8(9(19)16-10(20)15-7)18(17-6)3-4-21-5-11(12,13)14/h2-5H2,1H3,(H2,15,16,19,20) |
| InChIKey | XHFNXGLWOFWGDY-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 92.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|