About 6-[1-(1H-indazol-3-ylamino)isoquinolin-3-yl]sulfanyl-1,2-dihydroindazol-3-one
6-[1-(1H-indazol-3-ylamino)isoquinolin-3-yl]sulfanyl-1,2-dihydroindazol-3-one (PubChem CID 58935845) has the molecular formula C23H16N6OS
and a molecular weight of 424.49 g/mol. Its IUPAC name is 6-[1-(1H-indazol-3-ylamino)isoquinolin-3-yl]sulfanyl-1,2-dihydroindazol-3-one.
Molecular Properties
| Compound Name | 6-[1-(1H-indazol-3-ylamino)isoquinolin-3-yl]sulfanyl-1,2-dihydroindazol-3-one |
| PubChem CID | 58935845 |
| Molecular Formula | C23H16N6OS |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 6-[1-(1H-indazol-3-ylamino)isoquinolin-3-yl]sulfanyl-1,2-dihydroindazol-3-one |
| SMILES | O=c1[nH][nH]c2cc(Sc3cc4ccccc4c(Nc4n[nH]c5ccccc45)n3)ccc12 |
| InChI | InChI=1S/C23H16N6OS/c30-23-17-10-9-14(12-19(17)27-29-23)31-20-11-13-5-1-2-6-15(13)21(24-20)25-22-16-7-3-4-8-18(16)26-28-22/h1-12H,(H2,27,29,30)(H2,24,25,26,28) |
| InChIKey | YTFAHLBNLRZUCX-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 102.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[1-(1H-indazol-3-ylamino)isoquinolin-3-yl]sulfanyl-1,2-dihydroindazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[1-(1H-indazol-3-ylamino)isoquinolin-3-yl]sulfanyl-1,2-dihydroindazol-3-one?
The IUPAC name of 6-[1-(1H-indazol-3-ylamino)isoquinolin-3-yl]sulfanyl-1,2-dihydroindazol-3-one (CID 58935845) is 6-[1-(1H-indazol-3-ylamino)isoquinolin-3-yl]sulfanyl-1,2-dihydroindazol-3-one.
What is the SMILES notation for 6-[1-(1H-indazol-3-ylamino)isoquinolin-3-yl]sulfanyl-1,2-dihydroindazol-3-one?
The canonical SMILES for 6-[1-(1H-indazol-3-ylamino)isoquinolin-3-yl]sulfanyl-1,2-dihydroindazol-3-one is O=c1[nH][nH]c2cc(Sc3cc4ccccc4c(Nc4n[nH]c5ccccc45)n3)ccc12.
What is the InChIKey of 6-[1-(1H-indazol-3-ylamino)isoquinolin-3-yl]sulfanyl-1,2-dihydroindazol-3-one?
The InChIKey is YTFAHLBNLRZUCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16N6OS/c30-23-17-10-9-14(12-19(17)27-29-23)31-20-11-13-5-1-2-6-15(13)21(24-20)25-22-16-7-3-4-8-18(16)26-28-22/h1-12H,(H2,27,29,30)(H2,24,25,26,28).
What are the key properties of 6-[1-(1H-indazol-3-ylamino)isoquinolin-3-yl]sulfanyl-1,2-dihydroindazol-3-one?
6-[1-(1H-indazol-3-ylamino)isoquinolin-3-yl]sulfanyl-1,2-dihydroindazol-3-one has a molecular weight of 424.49 g/mol, XLogP of 5.18, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[1-(1H-indazol-3-ylamino)isoquinolin-3-yl]sulfanyl-1,2-dihydroindazol-3-one is sourced from PubChem (CID 58935845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).