C13H15N5O2S — CID 58935916
6-[2-[(5-methyl-1,3-thiazol-2-yl)amino]ethoxyamino]-1,2-dihydroindazol-3-one (PubChem CID 58935916) has the molecular formula C13H15N5O2S and a molecular weight of 305.36 g/mol. Its IUPAC name is 6-[2-[(5-methyl-1,3-thiazol-2-yl)amino]ethoxyamino]-1,2-dihydroindazol-3-one.
| Compound Name | 6-[2-[(5-methyl-1,3-thiazol-2-yl)amino]ethoxyamino]-1,2-dihydroindazol-3-one |
|---|---|
| PubChem CID | 58935916 |
| Molecular Formula | C13H15N5O2S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 6-[2-[(5-methyl-1,3-thiazol-2-yl)amino]ethoxyamino]-1,2-dihydroindazol-3-one |
| SMILES | Cc1cnc(NCCONc2ccc3c(=O)[nH][nH]c3c2)s1 |
| InChI | InChI=1S/C13H15N5O2S/c1-8-7-15-13(21-8)14-4-5-20-18-9-2-3-10-11(6-9)16-17-12(10)19/h2-3,6-7,18H,4-5H2,1H3,(H,14,15)(H2,16,17,19) |
| InChIKey | VSVLHNIICSHZEY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|