About 6-(3-aminopropylamino)-1,2-dihydroindazol-3-one
6-(3-aminopropylamino)-1,2-dihydroindazol-3-one (PubChem CID 58936020) has the molecular formula C10H14N4O
and a molecular weight of 206.25 g/mol. Its IUPAC name is 6-(3-aminopropylamino)-1,2-dihydroindazol-3-one.
Molecular Properties
| Compound Name | 6-(3-aminopropylamino)-1,2-dihydroindazol-3-one |
| PubChem CID | 58936020 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 6-(3-aminopropylamino)-1,2-dihydroindazol-3-one |
| SMILES | NCCCNc1ccc2c(=O)[nH][nH]c2c1 |
| InChI | InChI=1S/C10H14N4O/c11-4-1-5-12-7-2-3-8-9(6-7)13-14-10(8)15/h2-3,6,12H,1,4-5,11H2,(H2,13,14,15) |
| InChIKey | MAJVLXVOEPAUIP-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 86.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-aminopropylamino)-1,2-dihydroindazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-aminopropylamino)-1,2-dihydroindazol-3-one?
The IUPAC name of 6-(3-aminopropylamino)-1,2-dihydroindazol-3-one (CID 58936020) is 6-(3-aminopropylamino)-1,2-dihydroindazol-3-one.
What is the SMILES notation for 6-(3-aminopropylamino)-1,2-dihydroindazol-3-one?
The canonical SMILES for 6-(3-aminopropylamino)-1,2-dihydroindazol-3-one is NCCCNc1ccc2c(=O)[nH][nH]c2c1.
What is the InChIKey of 6-(3-aminopropylamino)-1,2-dihydroindazol-3-one?
The InChIKey is MAJVLXVOEPAUIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O/c11-4-1-5-12-7-2-3-8-9(6-7)13-14-10(8)15/h2-3,6,12H,1,4-5,11H2,(H2,13,14,15).
What are the key properties of 6-(3-aminopropylamino)-1,2-dihydroindazol-3-one?
6-(3-aminopropylamino)-1,2-dihydroindazol-3-one has a molecular weight of 206.25 g/mol, XLogP of 0.62, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-aminopropylamino)-1,2-dihydroindazol-3-one is sourced from PubChem (CID 58936020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).