C13H15N7O — CID 58936066
6-[3-(1,2,4-triazin-3-ylamino)propylamino]-1,2-dihydroindazol-3-one (PubChem CID 58936066) has the molecular formula C13H15N7O and a molecular weight of 285.31 g/mol. Its IUPAC name is 6-[3-(1,2,4-triazin-3-ylamino)propylamino]-1,2-dihydroindazol-3-one.
| Compound Name | 6-[3-(1,2,4-triazin-3-ylamino)propylamino]-1,2-dihydroindazol-3-one |
|---|---|
| PubChem CID | 58936066 |
| Molecular Formula | C13H15N7O |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 6-[3-(1,2,4-triazin-3-ylamino)propylamino]-1,2-dihydroindazol-3-one |
| SMILES | O=c1[nH][nH]c2cc(NCCCNc3nccnn3)ccc12 |
| InChI | InChI=1S/C13H15N7O/c21-12-10-3-2-9(8-11(10)18-19-12)14-4-1-5-15-13-16-6-7-17-20-13/h2-3,6-8,14H,1,4-5H2,(H,15,16,20)(H2,18,19,21) |
| InChIKey | YHGAPTGMYLCXBS-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|