About 3-[(3-oxo-1,2-dihydroindazol-6-yl)amino]propanoylazanide;yttrium
3-[(3-oxo-1,2-dihydroindazol-6-yl)amino]propanoylazanide;yttrium (PubChem CID 58936130) has the molecular formula C10H11N4O2Y-
and a molecular weight of 308.13 g/mol. Its IUPAC name is 3-[(3-oxo-1,2-dihydroindazol-6-yl)amino]propanoylazanide;yttrium.
Molecular Properties
| Compound Name | 3-[(3-oxo-1,2-dihydroindazol-6-yl)amino]propanoylazanide;yttrium |
| PubChem CID | 58936130 |
| Molecular Formula | C10H11N4O2Y- |
| Molecular Weight | 308.13 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | 3-[(3-oxo-1,2-dihydroindazol-6-yl)amino]propanoylazanide;yttrium |
| SMILES | [NH-]C(=O)CCNc1ccc2c(=O)[nH][nH]c2c1.[Y] |
| InChI | InChI=1S/C10H12N4O2.Y/c11-9(15)3-4-12-6-1-2-7-8(5-6)13-14-10(7)16;/h1-2,5H,3-4H2,(H5,11,12,13,14,15,16);/p-1 |
| InChIKey | LHBWHNLZFWYNQN-UHFFFAOYSA-M |
| XLogP | 1.23 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.13 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(3-oxo-1,2-dihydroindazol-6-yl)amino]propanoylazanide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-oxo-1,2-dihydroindazol-6-yl)amino]propanoylazanide;yttrium?
The IUPAC name of 3-[(3-oxo-1,2-dihydroindazol-6-yl)amino]propanoylazanide;yttrium (CID 58936130) is 3-[(3-oxo-1,2-dihydroindazol-6-yl)amino]propanoylazanide;yttrium.
What is the SMILES notation for 3-[(3-oxo-1,2-dihydroindazol-6-yl)amino]propanoylazanide;yttrium?
The canonical SMILES for 3-[(3-oxo-1,2-dihydroindazol-6-yl)amino]propanoylazanide;yttrium is [NH-]C(=O)CCNc1ccc2c(=O)[nH][nH]c2c1.[Y].
What is the InChIKey of 3-[(3-oxo-1,2-dihydroindazol-6-yl)amino]propanoylazanide;yttrium?
The InChIKey is LHBWHNLZFWYNQN-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H12N4O2.Y/c11-9(15)3-4-12-6-1-2-7-8(5-6)13-14-10(7)16;/h1-2,5H,3-4H2,(H5,11,12,13,14,15,16);/p-1.
What are the key properties of 3-[(3-oxo-1,2-dihydroindazol-6-yl)amino]propanoylazanide;yttrium?
3-[(3-oxo-1,2-dihydroindazol-6-yl)amino]propanoylazanide;yttrium has a molecular weight of 308.13 g/mol, XLogP of 1.23, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-oxo-1,2-dihydroindazol-6-yl)amino]propanoylazanide;yttrium is sourced from PubChem (CID 58936130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).