C16H22ClF2NO5S — CID 58936442
[(2S,3S)-1-chloro-4-(3,5-difluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butan-2-yl] methanesulfonate (PubChem CID 58936442) has the molecular formula C16H22ClF2NO5S and a molecular weight of 413.87 g/mol. Its IUPAC name is [(2S,3S)-1-chloro-4-(3,5-difluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butan-2-yl] methanesulfonate.
| Compound Name | [(2S,3S)-1-chloro-4-(3,5-difluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 58936442 |
| Molecular Formula | C16H22ClF2NO5S |
| Molecular Weight | 413.87 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | [(2S,3S)-1-chloro-4-(3,5-difluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butan-2-yl] methanesulfonate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1cc(F)cc(F)c1)[C@@H](CCl)OS(C)(=O)=O |
| InChI | InChI=1S/C16H22ClF2NO5S/c1-16(2,3)24-15(21)20-13(14(9-17)25-26(4,22)23)7-10-5-11(18)8-12(19)6-10/h5-6,8,13-14H,7,9H2,1-4H3,(H,20,21)/t13-,14+/m0/s1 |
| InChIKey | OCXKMMRXHQMZTK-UONOGXRCSA-N |
| XLogP | 2.98 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.87 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|