C26H19N3O4 — CID 58936546
3-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]-19-methoxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17(22),18,20-nonaene-12,14-dione (PubChem CID 58936546) has the molecular formula C26H19N3O4 and a molecular weight of 437.46 g/mol. Its IUPAC name is 3-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]-19-methoxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17(22),18,20-nonaene-12,14-dione.
| Compound Name | 3-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]-19-methoxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17(22),18,20-nonaene-12,14-dione |
|---|---|
| PubChem CID | 58936546 |
| Molecular Formula | C26H19N3O4 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 3-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]-19-methoxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17(22),18,20-nonaene-12,14-dione |
| SMILES | COc1ccc2[nH]c3c(c4c(c5c6ccccc6n([C@H]6C=C[C@@H](O)C6)c35)C(=O)NC4=O)c2c1 |
| InChI | InChI=1S/C26H19N3O4/c1-33-14-8-9-17-16(11-14)19-21-22(26(32)28-25(21)31)20-15-4-2-3-5-18(15)29(24(20)23(19)27-17)12-6-7-13(30)10-12/h2-9,11-13,27,30H,10H2,1H3,(H,28,31,32)/t12-,13+/m0/s1 |
| InChIKey | IWSARLRWKJUTBO-QWHCGFSZSA-N |
| XLogP | 4.18 |
| TPSA | 96.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|