C31H31BrClN3O3Si — CID 58936555
3-[5-bromo-1-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]-2-chloroindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 58936555) has the molecular formula C31H31BrClN3O3Si and a molecular weight of 637.05 g/mol. Its IUPAC name is 3-[5-bromo-1-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]-2-chloroindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[5-bromo-1-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]-2-chloroindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 58936555 |
| Molecular Formula | C31H31BrClN3O3Si |
| Molecular Weight | 637.05 g/mol |
| Exact Mass | 635.10 |
| IUPAC Name | 3-[5-bromo-1-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]-2-chloroindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C=C[C@H](n2c(Cl)c(C3=C(c4c[nH]c5ccccc45)C(=O)NC3=O)c3cc(Br)ccc32)C1 |
| InChI | InChI=1S/C31H31BrClN3O3Si/c1-31(2,3)40(4,5)39-19-12-11-18(15-19)36-24-13-10-17(32)14-21(24)25(28(36)33)27-26(29(37)35-30(27)38)22-16-34-23-9-7-6-8-20(22)23/h6-14,16,18-19,34H,15H2,1-5H3,(H,35,37,38)/t18-,19+/m0/s1 |
| InChIKey | ZXDVXUODJHZZFQ-RBUKOAKNSA-N |
| XLogP | 8.00 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.05 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|