C25H15BrN2O4 — CID 58936585
7-bromo-3-[(4S)-4-hydroxycyclopent-2-en-1-yl]-13-oxa-3,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione (PubChem CID 58936585) has the molecular formula C25H15BrN2O4 and a molecular weight of 487.31 g/mol. Its IUPAC name is 7-bromo-3-[(4S)-4-hydroxycyclopent-2-en-1-yl]-13-oxa-3,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione.
| Compound Name | 7-bromo-3-[(4S)-4-hydroxycyclopent-2-en-1-yl]-13-oxa-3,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione |
|---|---|
| PubChem CID | 58936585 |
| Molecular Formula | C25H15BrN2O4 |
| Molecular Weight | 487.31 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | 7-bromo-3-[(4S)-4-hydroxycyclopent-2-en-1-yl]-13-oxa-3,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione |
| SMILES | O=C1OC(=O)c2c1c1c3ccccc3[nH]c1c1c2c2cc(Br)ccc2n1C1C=C[C@@H](O)C1 |
| InChI | InChI=1S/C25H15BrN2O4/c26-11-5-8-17-15(9-11)19-21-20(24(30)32-25(21)31)18-14-3-1-2-4-16(14)27-22(18)23(19)28(17)12-6-7-13(29)10-12/h1-9,12-13,27,29H,10H2/t12?,13-/m1/s1 |
| InChIKey | HQJKZDGUEZXKSD-ZGTCLIOFSA-N |
| XLogP | 5.36 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.31 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|