C33H27N3O9 — CID 58936590
[(1S,2R,3S)-4-(13-acetyl-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-3-yl)-2,3-diacetyloxycyclopentyl] acetate (PubChem CID 58936590) has the molecular formula C33H27N3O9 and a molecular weight of 609.59 g/mol. Its IUPAC name is [(1S,2R,3S)-4-(13-acetyl-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-3-yl)-2,3-diacetyloxycyclopentyl] acetate.
| Compound Name | [(1S,2R,3S)-4-(13-acetyl-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-3-yl)-2,3-diacetyloxycyclopentyl] acetate |
|---|---|
| PubChem CID | 58936590 |
| Molecular Formula | C33H27N3O9 |
| Molecular Weight | 609.59 g/mol |
| Exact Mass | 609.17 |
| IUPAC Name | [(1S,2R,3S)-4-(13-acetyl-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-3-yl)-2,3-diacetyloxycyclopentyl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)CC(n2c3ccccc3c3c4c(c5c6ccccc6[nH]c5c32)C(=O)N(C(C)=O)C4=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C33H27N3O9/c1-14(37)35-32(41)26-24-18-9-5-7-11-20(18)34-28(24)29-25(27(26)33(35)42)19-10-6-8-12-21(19)36(29)22-13-23(43-15(2)38)31(45-17(4)40)30(22)44-16(3)39/h5-12,22-23,30-31,34H,13H2,1-4H3/t22?,23-,30-,31+/m0/s1 |
| InChIKey | FNQOMRIAZYIQQY-ABWTUAHOSA-N |
| XLogP | 4.31 |
| TPSA | 154.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.59 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|