C31H30BrN3O3Si — CID 58936609
7-bromo-3-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione (PubChem CID 58936609) has the molecular formula C31H30BrN3O3Si and a molecular weight of 600.59 g/mol. Its IUPAC name is 7-bromo-3-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione.
| Compound Name | 7-bromo-3-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione |
|---|---|
| PubChem CID | 58936609 |
| Molecular Formula | C31H30BrN3O3Si |
| Molecular Weight | 600.59 g/mol |
| Exact Mass | 599.12 |
| IUPAC Name | 7-bromo-3-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C=C[C@H](n2c3ccc(Br)cc3c3c4c(c5c6ccccc6[nH]c5c32)C(=O)NC4=O)C1 |
| InChI | InChI=1S/C31H30BrN3O3Si/c1-31(2,3)39(4,5)38-18-12-11-17(15-18)35-22-13-10-16(32)14-20(22)24-26-25(29(36)34-30(26)37)23-19-8-6-7-9-21(19)33-27(23)28(24)35/h6-14,17-18,33H,15H2,1-5H3,(H,34,36,37)/t17-,18+/m0/s1 |
| InChIKey | ANNYLMFGJDGVOY-ZWKOTPCHSA-N |
| XLogP | 7.97 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.59 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|