C36H27Br2N3O5 — CID 58936617
[(1R)-4-[7,19-dibromo-13-[(4-methoxyphenyl)methyl]-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaen-3-yl]cyclohex-2-en-1-yl] acetate (PubChem CID 58936617) has the molecular formula C36H27Br2N3O5 and a molecular weight of 741.44 g/mol. Its IUPAC name is [(1R)-4-[7,19-dibromo-13-[(4-methoxyphenyl)methyl]-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaen-3-yl]cyclohex-2-en-1-yl] acetate.
| Compound Name | [(1R)-4-[7,19-dibromo-13-[(4-methoxyphenyl)methyl]-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaen-3-yl]cyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 58936617 |
| Molecular Formula | C36H27Br2N3O5 |
| Molecular Weight | 741.44 g/mol |
| Exact Mass | 739.03 |
| IUPAC Name | [(1R)-4-[7,19-dibromo-13-[(4-methoxyphenyl)methyl]-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaen-3-yl]cyclohex-2-en-1-yl] acetate |
| SMILES | COc1ccc(CN2C(=O)c3c(c4c5cc(Br)ccc5n(C5C=C[C@H](OC(C)=O)CC5)c4c4[nH]c5ccc(Br)cc5c34)C2=O)cc1 |
| InChI | InChI=1S/C36H27Br2N3O5/c1-18(42)46-24-11-7-22(8-12-24)41-28-14-6-21(38)16-26(28)30-32-31(29-25-15-20(37)5-13-27(25)39-33(29)34(30)41)35(43)40(36(32)44)17-19-3-9-23(45-2)10-4-19/h3-7,9-11,13-16,22,24,39H,8,12,17H2,1-2H3/t22?,24-/m0/s1 |
| InChIKey | ONRDSJZRRWFWQK-GITCGBDTSA-N |
| XLogP | 8.58 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.44 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|