C32H33BrClN3O4Si — CID 58936627
3-[5-bromo-1-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]-2-chloroindol-3-yl]-4-(5-methoxy-1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 58936627) has the molecular formula C32H33BrClN3O4Si and a molecular weight of 667.08 g/mol. Its IUPAC name is 3-[5-bromo-1-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]-2-chloroindol-3-yl]-4-(5-methoxy-1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[5-bromo-1-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]-2-chloroindol-3-yl]-4-(5-methoxy-1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 58936627 |
| Molecular Formula | C32H33BrClN3O4Si |
| Molecular Weight | 667.08 g/mol |
| Exact Mass | 665.11 |
| IUPAC Name | 3-[5-bromo-1-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]-2-chloroindol-3-yl]-4-(5-methoxy-1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | COc1ccc2[nH]cc(C3=C(c4c(Cl)n([C@H]5C=C[C@@H](O[Si](C)(C)C(C)(C)C)C5)c5ccc(Br)cc45)C(=O)NC3=O)c2c1 |
| InChI | InChI=1S/C32H33BrClN3O4Si/c1-32(2,3)42(5,6)41-20-9-8-18(14-20)37-25-12-7-17(33)13-22(25)26(29(37)34)28-27(30(38)36-31(28)39)23-16-35-24-11-10-19(40-4)15-21(23)24/h7-13,15-16,18,20,35H,14H2,1-6H3,(H,36,38,39)/t18-,20+/m0/s1 |
| InChIKey | MSPRVWUKJQSCOC-AZUAARDMSA-N |
| XLogP | 8.01 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.08 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|