C32H33N3O4Si — CID 58936644
3-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]-19-methoxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17(22),18,20-nonaene-12,14-dione (PubChem CID 58936644) has the molecular formula C32H33N3O4Si and a molecular weight of 551.72 g/mol. Its IUPAC name is 3-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]-19-methoxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17(22),18,20-nonaene-12,14-dione.
| Compound Name | 3-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]-19-methoxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17(22),18,20-nonaene-12,14-dione |
|---|---|
| PubChem CID | 58936644 |
| Molecular Formula | C32H33N3O4Si |
| Molecular Weight | 551.72 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | 3-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]-19-methoxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17(22),18,20-nonaene-12,14-dione |
| SMILES | COc1ccc2[nH]c3c(c4c(c5c6ccccc6n([C@H]6C=C[C@@H](O[Si](C)(C)C(C)(C)C)C6)c35)C(=O)NC4=O)c2c1 |
| InChI | InChI=1S/C32H33N3O4Si/c1-32(2,3)40(5,6)39-19-12-11-17(15-19)35-23-10-8-7-9-20(23)25-27-26(30(36)34-31(27)37)24-21-16-18(38-4)13-14-22(21)33-28(24)29(25)35/h7-14,16-17,19,33H,15H2,1-6H3,(H,34,36,37)/t17-,19+/m0/s1 |
| InChIKey | DTNVUBKHMJZJLS-PKOBYXMFSA-N |
| XLogP | 7.21 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.72 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|