C30H23N3O6 — CID 58936672
[(1S)-4-(13-acetyl-7-methoxy-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaen-3-yl)cyclopent-2-en-1-yl] acetate (PubChem CID 58936672) has the molecular formula C30H23N3O6 and a molecular weight of 521.53 g/mol. Its IUPAC name is [(1S)-4-(13-acetyl-7-methoxy-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaen-3-yl)cyclopent-2-en-1-yl] acetate.
| Compound Name | [(1S)-4-(13-acetyl-7-methoxy-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaen-3-yl)cyclopent-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 58936672 |
| Molecular Formula | C30H23N3O6 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | [(1S)-4-(13-acetyl-7-methoxy-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaen-3-yl)cyclopent-2-en-1-yl] acetate |
| SMILES | COc1ccc2c(c1)c1c3c(c4c5ccccc5[nH]c4c1n2C1C=C[C@@H](OC(C)=O)C1)C(=O)N(C(C)=O)C3=O |
| InChI | InChI=1S/C30H23N3O6/c1-14(34)32-29(36)25-23-19-6-4-5-7-21(19)31-27(23)28-24(26(25)30(32)37)20-13-17(38-3)10-11-22(20)33(28)16-8-9-18(12-16)39-15(2)35/h4-11,13,16,18,31H,12H2,1-3H3/t16?,18-/m1/s1 |
| InChIKey | UHQDKUBHQBIIJA-UHUGOGIASA-N |
| XLogP | 5.01 |
| TPSA | 110.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|