C32H34ClN3O4Si — CID 58936675
3-[1-[(4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]-5-methoxyindol-3-yl]-4-(2-chloro-1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 58936675) has the molecular formula C32H34ClN3O4Si and a molecular weight of 588.18 g/mol. Its IUPAC name is 3-[1-[(4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]-5-methoxyindol-3-yl]-4-(2-chloro-1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-[(4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]-5-methoxyindol-3-yl]-4-(2-chloro-1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 58936675 |
| Molecular Formula | C32H34ClN3O4Si |
| Molecular Weight | 588.18 g/mol |
| Exact Mass | 587.20 |
| IUPAC Name | 3-[1-[(4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]-5-methoxyindol-3-yl]-4-(2-chloro-1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | COc1ccc2c(c1)c(C1=C(c3c(Cl)[nH]c4ccccc34)C(=O)NC1=O)cn2C1C=C[C@@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C32H34ClN3O4Si/c1-32(2,3)41(5,6)40-20-12-11-18(15-20)36-17-23(22-16-19(39-4)13-14-25(22)36)27-28(31(38)35-30(27)37)26-21-9-7-8-10-24(21)34-29(26)33/h7-14,16-18,20,34H,15H2,1-6H3,(H,35,37,38)/t18?,20-/m1/s1 |
| InChIKey | HULRNPYVSSPVQO-ROPPNANJSA-N |
| XLogP | 7.24 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.18 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|