C28H21N3O5 — CID 58936694
ethyl 3-[(4S)-4-hydroxycyclopent-2-en-1-yl]-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-13-carboxylate (PubChem CID 58936694) has the molecular formula C28H21N3O5 and a molecular weight of 479.49 g/mol. Its IUPAC name is ethyl 3-[(4S)-4-hydroxycyclopent-2-en-1-yl]-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-13-carboxylate.
| Compound Name | ethyl 3-[(4S)-4-hydroxycyclopent-2-en-1-yl]-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-13-carboxylate |
|---|---|
| PubChem CID | 58936694 |
| Molecular Formula | C28H21N3O5 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | ethyl 3-[(4S)-4-hydroxycyclopent-2-en-1-yl]-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-13-carboxylate |
| SMILES | CCOC(=O)N1C(=O)c2c(c3c4ccccc4n(C4C=C[C@@H](O)C4)c3c3[nH]c4ccccc4c23)C1=O |
| InChI | InChI=1S/C28H21N3O5/c1-2-36-28(35)31-26(33)22-20-16-7-3-5-9-18(16)29-24(20)25-21(23(22)27(31)34)17-8-4-6-10-19(17)30(25)14-11-12-15(32)13-14/h3-12,14-15,29,32H,2,13H2,1H3/t14?,15-/m1/s1 |
| InChIKey | KBPSJQXAPSEJST-YSSOQSIOSA-N |
| XLogP | 5.04 |
| TPSA | 104.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|