C11H15F7O — CID 58936755
4-methyl-5-(2,3,3,3-tetrafluoro-2-methylpropoxy)-2-(trifluoromethyl)pent-1-ene (PubChem CID 58936755) has the molecular formula C11H15F7O and a molecular weight of 296.23 g/mol. Its IUPAC name is 4-methyl-5-(2,3,3,3-tetrafluoro-2-methylpropoxy)-2-(trifluoromethyl)pent-1-ene.
| Compound Name | 4-methyl-5-(2,3,3,3-tetrafluoro-2-methylpropoxy)-2-(trifluoromethyl)pent-1-ene |
|---|---|
| PubChem CID | 58936755 |
| Molecular Formula | C11H15F7O |
| Molecular Weight | 296.23 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 4-methyl-5-(2,3,3,3-tetrafluoro-2-methylpropoxy)-2-(trifluoromethyl)pent-1-ene |
| SMILES | C=C(CC(C)COCC(C)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H15F7O/c1-7(4-8(2)10(13,14)15)5-19-6-9(3,12)11(16,17)18/h7H,2,4-6H2,1,3H3 |
| InChIKey | IJBUFBXAWAFBJG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.23 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|