C35H43F5N4O5 — CID 58936842
(2,3,4,5,6-pentafluorophenyl) (2S)-4-(tert-butylamino)-2-[[(2S)-3-(1H-indol-3-yl)-2-(nonoxymethylideneamino)propanoyl]amino]-4-oxobutanoate (PubChem CID 58936842) has the molecular formula C35H43F5N4O5 and a molecular weight of 694.74 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (2S)-4-(tert-butylamino)-2-[[(2S)-3-(1H-indol-3-yl)-2-(nonoxymethylideneamino)propanoyl]amino]-4-oxobutanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (2S)-4-(tert-butylamino)-2-[[(2S)-3-(1H-indol-3-yl)-2-(nonoxymethylideneamino)propanoyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 58936842 |
| Molecular Formula | C35H43F5N4O5 |
| Molecular Weight | 694.74 g/mol |
| Exact Mass | 694.32 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (2S)-4-(tert-butylamino)-2-[[(2S)-3-(1H-indol-3-yl)-2-(nonoxymethylideneamino)propanoyl]amino]-4-oxobutanoate |
| SMILES | CCCCCCCCCO/C=N/[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CC(=O)NC(C)(C)C)C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C35H43F5N4O5/c1-5-6-7-8-9-10-13-16-48-20-42-24(17-21-19-41-23-15-12-11-14-22(21)23)33(46)43-25(18-26(45)44-35(2,3)4)34(47)49-32-30(39)28(37)27(36)29(38)31(32)40/h11-12,14-15,19-20,24-25,41H,5-10,13,16-18H2,1-4H3,(H,43,46)(H,44,45)/b42-20+/t24-,25-/m0/s1 |
| InChIKey | CORPYVKBMRAZDM-BCMILPCSSA-N |
| XLogP | 6.97 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.74 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|