C31H35F5N4O5 — CID 58936851
(2,3,4,5,6-pentafluorophenyl) (2R)-4-amino-2-[[(2S)-2-(decanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoate (PubChem CID 58936851) has the molecular formula C31H35F5N4O5 and a molecular weight of 638.63 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (2R)-4-amino-2-[[(2S)-2-(decanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (2R)-4-amino-2-[[(2S)-2-(decanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 58936851 |
| Molecular Formula | C31H35F5N4O5 |
| Molecular Weight | 638.63 g/mol |
| Exact Mass | 638.25 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (2R)-4-amino-2-[[(2S)-2-(decanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoate |
| SMILES | CCCCCCCCCC(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@H](CC(N)=O)C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C31H35F5N4O5/c1-2-3-4-5-6-7-8-13-23(42)39-20(14-17-16-38-19-12-10-9-11-18(17)19)30(43)40-21(15-22(37)41)31(44)45-29-27(35)25(33)24(32)26(34)28(29)36/h9-12,16,20-21,38H,2-8,13-15H2,1H3,(H2,37,41)(H,39,42)(H,40,43)/t20-,21+/m0/s1 |
| InChIKey | NRSQTXNSNIASOI-LEWJYISDSA-N |
| XLogP | 5.00 |
| TPSA | 143.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.63 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|