About 2-(benzotriazol-2-yl)-4-methylphenol;iridium;2-phenylquinoline
2-(benzotriazol-2-yl)-4-methylphenol;iridium;2-phenylquinoline (PubChem CID 58937517) has the molecular formula C28H21IrN4O-
and a molecular weight of 621.72 g/mol. Its IUPAC name is 2-(benzotriazol-2-yl)-4-methylphenol;iridium;2-phenylquinoline.
Molecular Properties
| Compound Name | 2-(benzotriazol-2-yl)-4-methylphenol;iridium;2-phenylquinoline |
| PubChem CID | 58937517 |
| Molecular Formula | C28H21IrN4O- |
| Molecular Weight | 621.72 g/mol |
| Exact Mass | 622.14 |
| IUPAC Name | 2-(benzotriazol-2-yl)-4-methylphenol;iridium;2-phenylquinoline |
| SMILES | Cc1ccc(O)c(-n2nc3ccccc3n2)c1.[Ir].[c-]1ccccc1-c1ccc2ccccc2n1 |
| InChI | InChI=1S/C15H10N.C13H11N3O.Ir/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15;1-9-6-7-13(17)12(8-9)16-14-10-4-2-3-5-11(10)15-16;/h1-6,8-11H;2-8,17H,1H3;/q-1;; |
| InChIKey | XSOHOYHDEWWMTP-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 621.72 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-(benzotriazol-2-yl)-4-methylphenol;iridium;2-phenylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzotriazol-2-yl)-4-methylphenol;iridium;2-phenylquinoline?
The IUPAC name of 2-(benzotriazol-2-yl)-4-methylphenol;iridium;2-phenylquinoline (CID 58937517) is 2-(benzotriazol-2-yl)-4-methylphenol;iridium;2-phenylquinoline.
What is the SMILES notation for 2-(benzotriazol-2-yl)-4-methylphenol;iridium;2-phenylquinoline?
The canonical SMILES for 2-(benzotriazol-2-yl)-4-methylphenol;iridium;2-phenylquinoline is Cc1ccc(O)c(-n2nc3ccccc3n2)c1.[Ir].[c-]1ccccc1-c1ccc2ccccc2n1.
What is the InChIKey of 2-(benzotriazol-2-yl)-4-methylphenol;iridium;2-phenylquinoline?
The InChIKey is XSOHOYHDEWWMTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N.C13H11N3O.Ir/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15;1-9-6-7-13(17)12(8-9)16-14-10-4-2-3-5-11(10)15-16;/h1-6,8-11H;2-8,17H,1H3;/q-1;;.
What are the key properties of 2-(benzotriazol-2-yl)-4-methylphenol;iridium;2-phenylquinoline?
2-(benzotriazol-2-yl)-4-methylphenol;iridium;2-phenylquinoline has a molecular weight of 621.72 g/mol, XLogP of 6.13, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzotriazol-2-yl)-4-methylphenol;iridium;2-phenylquinoline is sourced from PubChem (CID 58937517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).