C31H53FN4O8 — CID 58937546
2-[4-[[3-(isocyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamoyloxy]butoxy]ethyl N-[[5-(fluoromethoxycarbonylamino)-1,3,3-trimethylcyclohexyl]methyl]carbamate (PubChem CID 58937546) has the molecular formula C31H53FN4O8 and a molecular weight of 628.78 g/mol. Its IUPAC name is 2-[4-[[3-(isocyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamoyloxy]butoxy]ethyl N-[[5-(fluoromethoxycarbonylamino)-1,3,3-trimethylcyclohexyl]methyl]carbamate.
| Compound Name | 2-[4-[[3-(isocyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamoyloxy]butoxy]ethyl N-[[5-(fluoromethoxycarbonylamino)-1,3,3-trimethylcyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 58937546 |
| Molecular Formula | C31H53FN4O8 |
| Molecular Weight | 628.78 g/mol |
| Exact Mass | 628.38 |
| IUPAC Name | 2-[4-[[3-(isocyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamoyloxy]butoxy]ethyl N-[[5-(fluoromethoxycarbonylamino)-1,3,3-trimethylcyclohexyl]methyl]carbamate |
| SMILES | CC1(C)CC(NC(=O)OCCCCOCCOC(=O)NCC2(C)CC(NC(=O)OCF)CC(C)(C)C2)CC(C)(CN=C=O)C1 |
| InChI | InChI=1S/C31H53FN4O8/c1-28(2)13-23(15-30(5,17-28)19-33-22-37)35-26(39)42-10-8-7-9-41-11-12-43-25(38)34-20-31(6)16-24(14-29(3,4)18-31)36-27(40)44-21-32/h23-24H,7-21H2,1-6H3,(H,34,38)(H,35,39)(H,36,40) |
| InChIKey | NOFDAKABAAGPTO-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 153.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.78 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|