About 2-fluoroethyl N-[3-(cyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate
2-fluoroethyl N-[3-(cyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate (PubChem CID 58937548) has the molecular formula C14H23FN2O3
and a molecular weight of 286.35 g/mol. Its IUPAC name is 2-fluoroethyl N-[3-(cyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate.
Molecular Properties
| Compound Name | 2-fluoroethyl N-[3-(cyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate |
| PubChem CID | 58937548 |
| Molecular Formula | C14H23FN2O3 |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 2-fluoroethyl N-[3-(cyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate |
| SMILES | CC1(C)CC(NC(=O)OCCF)CC(C)(COC#N)C1 |
| InChI | InChI=1S/C14H23FN2O3/c1-13(2)6-11(17-12(18)20-5-4-15)7-14(3,8-13)9-19-10-16/h11H,4-9H2,1-3H3,(H,17,18) |
| InChIKey | RKIZWPUYWQLALV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoroethyl N-[3-(cyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroethyl N-[3-(cyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate?
The IUPAC name of 2-fluoroethyl N-[3-(cyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate (CID 58937548) is 2-fluoroethyl N-[3-(cyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate.
What is the SMILES notation for 2-fluoroethyl N-[3-(cyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate?
The canonical SMILES for 2-fluoroethyl N-[3-(cyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate is CC1(C)CC(NC(=O)OCCF)CC(C)(COC#N)C1.
What is the InChIKey of 2-fluoroethyl N-[3-(cyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate?
The InChIKey is RKIZWPUYWQLALV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23FN2O3/c1-13(2)6-11(17-12(18)20-5-4-15)7-14(3,8-13)9-19-10-16/h11H,4-9H2,1-3H3,(H,17,18).
What are the key properties of 2-fluoroethyl N-[3-(cyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate?
2-fluoroethyl N-[3-(cyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate has a molecular weight of 286.35 g/mol, XLogP of 2.76, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroethyl N-[3-(cyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate is sourced from PubChem (CID 58937548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).