C13H13F11N2O3 — CID 58937557
2-methyl-N-[3-[[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl]amino]propyl]prop-2-enamide (PubChem CID 58937557) has the molecular formula C13H13F11N2O3 and a molecular weight of 454.24 g/mol. Its IUPAC name is 2-methyl-N-[3-[[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl]amino]propyl]prop-2-enamide.
| Compound Name | 2-methyl-N-[3-[[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl]amino]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 58937557 |
| Molecular Formula | C13H13F11N2O3 |
| Molecular Weight | 454.24 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 2-methyl-N-[3-[[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl]amino]propyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCNC(=O)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H13F11N2O3/c1-6(2)7(27)25-4-3-5-26-8(28)9(14,11(17,18)19)29-13(23,24)10(15,16)12(20,21)22/h1,3-5H2,2H3,(H,25,27)(H,26,28) |
| InChIKey | RKPHKBIWCJZSRY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|