C29H20F3IrN2O3- — CID 58937596
iridium;2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyridine-3-carboxylic acid;2-phenylquinoline (PubChem CID 58937596) has the molecular formula C29H20F3IrN2O3- and a molecular weight of 693.70 g/mol. Its IUPAC name is iridium;2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyridine-3-carboxylic acid;2-phenylquinoline.
| Compound Name | iridium;2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyridine-3-carboxylic acid;2-phenylquinoline |
|---|---|
| PubChem CID | 58937596 |
| Molecular Formula | C29H20F3IrN2O3- |
| Molecular Weight | 693.70 g/mol |
| Exact Mass | 694.11 |
| IUPAC Name | iridium;2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyridine-3-carboxylic acid;2-phenylquinoline |
| SMILES | O=C(O)c1cccn(Cc2cccc(C(F)(F)F)c2)c1=O.[Ir].[c-]1ccccc1-c1ccc2ccccc2n1 |
| InChI | InChI=1S/C15H10N.C14H10F3NO3.Ir/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15;15-14(16,17)10-4-1-3-9(7-10)8-18-6-2-5-11(12(18)19)13(20)21;/h1-6,8-11H;1-7H,8H2,(H,20,21);/q-1;; |
| InChIKey | UQFNNMBUEJAMCP-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.70 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|