C27H36F8O4 — CID 58937682
2,2,3,3,4,4,5,5-octafluoropentyl 9,10-dimethyl-4-[2-(3-methylbutoxy)-2-oxoethyl]tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate (PubChem CID 58937682) has the molecular formula C27H36F8O4 and a molecular weight of 576.57 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoropentyl 9,10-dimethyl-4-[2-(3-methylbutoxy)-2-oxoethyl]tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoropentyl 9,10-dimethyl-4-[2-(3-methylbutoxy)-2-oxoethyl]tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
|---|---|
| PubChem CID | 58937682 |
| Molecular Formula | C27H36F8O4 |
| Molecular Weight | 576.57 g/mol |
| Exact Mass | 576.25 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoropentyl 9,10-dimethyl-4-[2-(3-methylbutoxy)-2-oxoethyl]tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
| SMILES | CC(C)CCOC(=O)CC1(C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)CC2CC1C1C3CC(C(C)C3C)C21 |
| InChI | InChI=1S/C27H36F8O4/c1-12(2)5-6-38-19(36)10-24(23(37)39-11-25(30,31)27(34,35)26(32,33)22(28)29)9-15-7-18(24)21-17-8-16(20(15)21)13(3)14(17)4/h12-18,20-22H,5-11H2,1-4H3 |
| InChIKey | CCUKKAWROGAPSF-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.57 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|