C18H20F6O3 — CID 58937700
[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-bicyclo[2.2.1]heptanyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 58937700) has the molecular formula C18H20F6O3 and a molecular weight of 398.34 g/mol. Its IUPAC name is [2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-bicyclo[2.2.1]heptanyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-bicyclo[2.2.1]heptanyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 58937700 |
| Molecular Formula | C18H20F6O3 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | [2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-bicyclo[2.2.1]heptanyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(OC1(C(O)(C(F)(F)F)C(F)(F)F)CC2CCC1C2)C1CC2C=CC1C2 |
| InChI | InChI=1S/C18H20F6O3/c19-17(20,21)16(26,18(22,23)24)15(8-10-2-4-12(15)6-10)27-14(25)13-7-9-1-3-11(13)5-9/h1,3,9-13,26H,2,4-8H2 |
| InChIKey | ZWIKBEHAUOUBFZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|