C16H26N3O13P2- — CID 58937771
[(2S,4S)-4-amino-3-hydroxy-6-methyloxan-2-yl] [[(2R,4S,5R)-3,4-dihydroxy-5-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphate (PubChem CID 58937771) has the molecular formula C16H26N3O13P2- and a molecular weight of 530.34 g/mol. Its IUPAC name is [(2S,4S)-4-amino-3-hydroxy-6-methyloxan-2-yl] [[(2R,4S,5R)-3,4-dihydroxy-5-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphate.
| Compound Name | [(2S,4S)-4-amino-3-hydroxy-6-methyloxan-2-yl] [[(2R,4S,5R)-3,4-dihydroxy-5-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphate |
|---|---|
| PubChem CID | 58937771 |
| Molecular Formula | C16H26N3O13P2- |
| Molecular Weight | 530.34 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | [(2S,4S)-4-amino-3-hydroxy-6-methyloxan-2-yl] [[(2R,4S,5R)-3,4-dihydroxy-5-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphate |
| SMILES | C=C1NC(=O)C=CN1[C@@H]1O[C@H](COP(=O)(O)OP(=O)([O-])O[C@@H]2OC(C)C[C@H](N)C2O)C(O)[C@@H]1O |
| InChI | InChI=1S/C16H27N3O13P2/c1-7-5-9(17)12(21)16(29-7)31-34(26,27)32-33(24,25)28-6-10-13(22)14(23)15(30-10)19-4-3-11(20)18-8(19)2/h3-4,7,9-10,12-16,21-23H,2,5-6,17H2,1H3,(H,18,20)(H,24,25)(H,26,27)/p-1/t7?,9-,10+,12?,13?,14-,15+,16-/m0/s1 |
| InChIKey | UWCYBVDSGRJWGS-DKGIZHLMSA-M |
| XLogP | -2.71 |
| TPSA | 242.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.34 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|