About 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-1-piperidin-2-ylpentan-1-ol
1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-1-piperidin-2-ylpentan-1-ol (PubChem CID 58937931) has the molecular formula C21H24F6N2O
and a molecular weight of 434.42 g/mol. Its IUPAC name is 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-1-piperidin-2-ylpentan-1-ol.
Molecular Properties
| Compound Name | 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-1-piperidin-2-ylpentan-1-ol |
| PubChem CID | 58937931 |
| Molecular Formula | C21H24F6N2O |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-1-piperidin-2-ylpentan-1-ol |
| SMILES | CCCCC(O)(c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12)C1CCCCN1 |
| InChI | InChI=1S/C21H24F6N2O/c1-2-3-10-19(30,16-9-4-5-11-28-16)15-12-17(21(25,26)27)29-18-13(15)7-6-8-14(18)20(22,23)24/h6-8,12,16,28,30H,2-5,9-11H2,1H3 |
| InChIKey | SYIWYBMCRYBETB-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-1-piperidin-2-ylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-1-piperidin-2-ylpentan-1-ol?
The IUPAC name of 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-1-piperidin-2-ylpentan-1-ol (CID 58937931) is 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-1-piperidin-2-ylpentan-1-ol.
What is the SMILES notation for 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-1-piperidin-2-ylpentan-1-ol?
The canonical SMILES for 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-1-piperidin-2-ylpentan-1-ol is CCCCC(O)(c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12)C1CCCCN1.
What is the InChIKey of 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-1-piperidin-2-ylpentan-1-ol?
The InChIKey is SYIWYBMCRYBETB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24F6N2O/c1-2-3-10-19(30,16-9-4-5-11-28-16)15-12-17(21(25,26)27)29-18-13(15)7-6-8-14(18)20(22,23)24/h6-8,12,16,28,30H,2-5,9-11H2,1H3.
What are the key properties of 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-1-piperidin-2-ylpentan-1-ol?
1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-1-piperidin-2-ylpentan-1-ol has a molecular weight of 434.42 g/mol, XLogP of 5.79, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-1-piperidin-2-ylpentan-1-ol is sourced from PubChem (CID 58937931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).