C34H38F5N3O4 — CID 58938036
4,4,5,5,5-pentafluoropentyl 3-[[3,3-diphenylpropyl(2-morpholin-4-ylethyl)carbamoyl]amino]benzoate (PubChem CID 58938036) has the molecular formula C34H38F5N3O4 and a molecular weight of 647.69 g/mol. Its IUPAC name is 4,4,5,5,5-pentafluoropentyl 3-[[3,3-diphenylpropyl(2-morpholin-4-ylethyl)carbamoyl]amino]benzoate.
| Compound Name | 4,4,5,5,5-pentafluoropentyl 3-[[3,3-diphenylpropyl(2-morpholin-4-ylethyl)carbamoyl]amino]benzoate |
|---|---|
| PubChem CID | 58938036 |
| Molecular Formula | C34H38F5N3O4 |
| Molecular Weight | 647.69 g/mol |
| Exact Mass | 647.28 |
| IUPAC Name | 4,4,5,5,5-pentafluoropentyl 3-[[3,3-diphenylpropyl(2-morpholin-4-ylethyl)carbamoyl]amino]benzoate |
| SMILES | O=C(OCCCC(F)(F)C(F)(F)F)c1cccc(NC(=O)N(CCC(c2ccccc2)c2ccccc2)CCN2CCOCC2)c1 |
| InChI | InChI=1S/C34H38F5N3O4/c35-33(36,34(37,38)39)16-8-22-46-31(43)28-13-7-14-29(25-28)40-32(44)42(19-18-41-20-23-45-24-21-41)17-15-30(26-9-3-1-4-10-26)27-11-5-2-6-12-27/h1-7,9-14,25,30H,8,15-24H2,(H,40,44) |
| InChIKey | NBMYDFZOWOQBQJ-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.69 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|