C11H11BrFN — CID 58938108
6-(4-bromo-3-fluorophenyl)-2,3,4,5-tetrahydropyridine (PubChem CID 58938108) has the molecular formula C11H11BrFN and a molecular weight of 256.12 g/mol. Its IUPAC name is 6-(4-bromo-3-fluorophenyl)-2,3,4,5-tetrahydropyridine.
| Compound Name | 6-(4-bromo-3-fluorophenyl)-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 58938108 |
| Molecular Formula | C11H11BrFN |
| Molecular Weight | 256.12 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | 6-(4-bromo-3-fluorophenyl)-2,3,4,5-tetrahydropyridine |
| SMILES | Fc1cc(C2=NCCCC2)ccc1Br |
| InChI | InChI=1S/C11H11BrFN/c12-9-5-4-8(7-10(9)13)11-3-1-2-6-14-11/h4-5,7H,1-3,6H2 |
| InChIKey | NVEUYCPGPOWXRA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.12 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |