About (2S)-1-[3,5-bis(trifluoromethyl)phenyl]-2,4-dimethylpiperazine
(2S)-1-[3,5-bis(trifluoromethyl)phenyl]-2,4-dimethylpiperazine (PubChem CID 58938270) has the molecular formula C14H16F6N2
and a molecular weight of 326.28 g/mol. Its IUPAC name is (2S)-1-[3,5-bis(trifluoromethyl)phenyl]-2,4-dimethylpiperazine.
Molecular Properties
| Compound Name | (2S)-1-[3,5-bis(trifluoromethyl)phenyl]-2,4-dimethylpiperazine |
| PubChem CID | 58938270 |
| Molecular Formula | C14H16F6N2 |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (2S)-1-[3,5-bis(trifluoromethyl)phenyl]-2,4-dimethylpiperazine |
| SMILES | C[C@H]1CN(C)CCN1c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F6N2/c1-9-8-21(2)3-4-22(9)12-6-10(13(15,16)17)5-11(7-12)14(18,19)20/h5-7,9H,3-4,8H2,1-2H3/t9-/m0/s1 |
| InChIKey | WHTSMYGJJMMKBA-VIFPVBQESA-N |
| XLogP | 3.86 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-1-[3,5-bis(trifluoromethyl)phenyl]-2,4-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-[3,5-bis(trifluoromethyl)phenyl]-2,4-dimethylpiperazine?
The IUPAC name of (2S)-1-[3,5-bis(trifluoromethyl)phenyl]-2,4-dimethylpiperazine (CID 58938270) is (2S)-1-[3,5-bis(trifluoromethyl)phenyl]-2,4-dimethylpiperazine.
What is the SMILES notation for (2S)-1-[3,5-bis(trifluoromethyl)phenyl]-2,4-dimethylpiperazine?
The canonical SMILES for (2S)-1-[3,5-bis(trifluoromethyl)phenyl]-2,4-dimethylpiperazine is C[C@H]1CN(C)CCN1c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of (2S)-1-[3,5-bis(trifluoromethyl)phenyl]-2,4-dimethylpiperazine?
The InChIKey is WHTSMYGJJMMKBA-VIFPVBQESA-N. The full InChI is InChI=1S/C14H16F6N2/c1-9-8-21(2)3-4-22(9)12-6-10(13(15,16)17)5-11(7-12)14(18,19)20/h5-7,9H,3-4,8H2,1-2H3/t9-/m0/s1.
What are the key properties of (2S)-1-[3,5-bis(trifluoromethyl)phenyl]-2,4-dimethylpiperazine?
(2S)-1-[3,5-bis(trifluoromethyl)phenyl]-2,4-dimethylpiperazine has a molecular weight of 326.28 g/mol, XLogP of 3.86, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-[3,5-bis(trifluoromethyl)phenyl]-2,4-dimethylpiperazine is sourced from PubChem (CID 58938270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).