C17H31NO3 — CID 58938939
2-(oxan-4-yl)-N-(2,2,5,5-tetramethyl-4-oxohexan-3-yl)acetamide (PubChem CID 58938939) has the molecular formula C17H31NO3 and a molecular weight of 297.44 g/mol. Its IUPAC name is 2-(oxan-4-yl)-N-(2,2,5,5-tetramethyl-4-oxohexan-3-yl)acetamide.
| Compound Name | 2-(oxan-4-yl)-N-(2,2,5,5-tetramethyl-4-oxohexan-3-yl)acetamide |
|---|---|
| PubChem CID | 58938939 |
| Molecular Formula | C17H31NO3 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | 2-(oxan-4-yl)-N-(2,2,5,5-tetramethyl-4-oxohexan-3-yl)acetamide |
| SMILES | CC(C)(C)C(=O)C(NC(=O)CC1CCOCC1)C(C)(C)C |
| InChI | InChI=1S/C17H31NO3/c1-16(2,3)14(15(20)17(4,5)6)18-13(19)11-12-7-9-21-10-8-12/h12,14H,7-11H2,1-6H3,(H,18,19) |
| InChIKey | VZBJNJJDBROAAN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |