C21H23ClO — CID 58939172
5'-chloro-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5-ol (PubChem CID 58939172) has the molecular formula C21H23ClO and a molecular weight of 326.87 g/mol. Its IUPAC name is 5'-chloro-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5-ol.
| Compound Name | 5'-chloro-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5-ol |
|---|---|
| PubChem CID | 58939172 |
| Molecular Formula | C21H23ClO |
| Molecular Weight | 326.87 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 5'-chloro-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5-ol |
| SMILES | CC1(C)CC2(CC(C)(C)c3ccc(Cl)cc32)c2cc(O)ccc21 |
| InChI | InChI=1S/C21H23ClO/c1-19(2)11-21(17-9-13(22)5-7-15(17)19)12-20(3,4)16-8-6-14(23)10-18(16)21/h5-10,23H,11-12H2,1-4H3 |
| InChIKey | HWMLJKFVMTVMJT-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.87 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |