About 4-(furan-2-yl)pyridine
4-(furan-2-yl)pyridine (PubChem CID 589392) has the molecular formula C9H7NO
and a molecular weight of 145.16 g/mol. Its IUPAC name is 4-(furan-2-yl)pyridine.
Molecular Properties
| Compound Name | 4-(furan-2-yl)pyridine |
| PubChem CID | 589392 |
| Molecular Formula | C9H7NO |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.05 |
| IUPAC Name | 4-(furan-2-yl)pyridine |
| SMILES | c1coc(-c2ccncc2)c1 |
| InChI | InChI=1S/C9H7NO/c1-2-9(11-7-1)8-3-5-10-6-4-8/h1-7H |
| InChIKey | ZKFCBMREQURXHM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(furan-2-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(furan-2-yl)pyridine?
The IUPAC name of 4-(furan-2-yl)pyridine (CID 589392) is 4-(furan-2-yl)pyridine.
What is the SMILES notation for 4-(furan-2-yl)pyridine?
The canonical SMILES for 4-(furan-2-yl)pyridine is c1coc(-c2ccncc2)c1.
What is the InChIKey of 4-(furan-2-yl)pyridine?
The InChIKey is ZKFCBMREQURXHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO/c1-2-9(11-7-1)8-3-5-10-6-4-8/h1-7H.
What are the key properties of 4-(furan-2-yl)pyridine?
4-(furan-2-yl)pyridine has a molecular weight of 145.16 g/mol, XLogP of 2.34, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(furan-2-yl)pyridine is sourced from PubChem (CID 589392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).