About carbanide;4-methylpent-4-en-2-ylideneazanide;platinum(4+)
carbanide;4-methylpent-4-en-2-ylideneazanide;platinum(4+) (PubChem CID 58939459) has the molecular formula C8H15NPt
and a molecular weight of 320.29 g/mol. Its IUPAC name is carbanide;4-methylpent-4-en-2-ylideneazanide;platinum(4+).
Molecular Properties
| Compound Name | carbanide;4-methylpent-4-en-2-ylideneazanide;platinum(4+) |
| PubChem CID | 58939459 |
| Molecular Formula | C8H15NPt |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | carbanide;4-methylpent-4-en-2-ylideneazanide;platinum(4+) |
| SMILES | [CH3-].[CH3-].[H]/[C-]=C(\C)CC(C)=[N-].[Pt+4] |
| InChI | InChI=1S/C6H9N.2CH3.Pt/c1-5(2)4-6(3)7;;;/h1H,4H2,2-3H3;2*1H3;/q-2;2*-1;+4 |
| InChIKey | CKSJFFOPAUNOTJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 22.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze carbanide;4-methylpent-4-en-2-ylideneazanide;platinum(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;4-methylpent-4-en-2-ylideneazanide;platinum(4+)?
The IUPAC name of carbanide;4-methylpent-4-en-2-ylideneazanide;platinum(4+) (CID 58939459) is carbanide;4-methylpent-4-en-2-ylideneazanide;platinum(4+).
What is the SMILES notation for carbanide;4-methylpent-4-en-2-ylideneazanide;platinum(4+)?
The canonical SMILES for carbanide;4-methylpent-4-en-2-ylideneazanide;platinum(4+) is [CH3-].[CH3-].[H]/[C-]=C(\C)CC(C)=[N-].[Pt+4].
What is the InChIKey of carbanide;4-methylpent-4-en-2-ylideneazanide;platinum(4+)?
The InChIKey is CKSJFFOPAUNOTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N.2CH3.Pt/c1-5(2)4-6(3)7;;;/h1H,4H2,2-3H3;2*1H3;/q-2;2*-1;+4.
What are the key properties of carbanide;4-methylpent-4-en-2-ylideneazanide;platinum(4+)?
carbanide;4-methylpent-4-en-2-ylideneazanide;platinum(4+) has a molecular weight of 320.29 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;4-methylpent-4-en-2-ylideneazanide;platinum(4+) is sourced from PubChem (CID 58939459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).